CAS 876353-77-4 is the registry number for tert-Butyl N-(2,3-dichlorophenyl)carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Tert-butyl N-(2,3-dichlorophenyl)carbamate (CAS 876353-77-4) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: tert-butyl N-(2,3-dichlorophenyl)carbamate. InChIKey: IKUBTZVYDQBYTO-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | tert-butyl N-(2,3-dichlorophenyl)carbamate |
| InChIKey | IKUBTZVYDQBYTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)