CAS 25217-40-7 is the registry number for tert-Butyl 3,4-dichlorophenylcarbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl N-(3,4-dichlorophenyl)carbamate (CAS 25217-40-7) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: tert-butyl N-(3,4-dichlorophenyl)carbamate. InChIKey: CYPVZIKQSSCHAZ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | tert-butyl N-(3,4-dichlorophenyl)carbamate |
| InChIKey | CYPVZIKQSSCHAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)