CAS 1630754-41-4 is the registry number for tert-Butyl 2,6-dichloro-4-methylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,6-dichloro-4-methylpyridine-3-carboxylate (CAS 1630754-41-4) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: tert-butyl 2,6-dichloro-4-methylpyridine-3-carboxylate. InChIKey: STKQJGNQQYWQEE-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | tert-butyl 2,6-dichloro-4-methylpyridine-3-carboxylate |
| InChIKey | STKQJGNQQYWQEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)OC(C)(C)C)Cl)Cl |
Computed by PubChem (NCBI)