CAS 1260777-79-4 is the registry number for 4-Morpholinobenzoyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-morpholin-4-ylbenzoyl chloride;hydrochloride (CAS 1260777-79-4) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: 4-morpholin-4-ylbenzoyl chloride;hydrochloride. InChIKey: FEPUKWZIWAYMHC-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 4-morpholin-4-ylbenzoyl chloride;hydrochloride |
| InChIKey | FEPUKWZIWAYMHC-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)C(=O)Cl.Cl |
Computed by PubChem (NCBI)