CAS 1807940-40-4 appears in our catalog under these names: Trans-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid-hydrochloride, Trans-4-(4-Chlorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 5g, 10g, 1g.
(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1807940-40-4) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: OIMCKZOWSJOMID-BAUSSPIASA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | OIMCKZOWSJOMID-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)