CAS 1049744-24-2 appears in our catalog under these names: 3-(3-Aminophenyl)benzonitrile hydrochloride, 98%, 3'-Amino-biphenyl-3-carbonitrilehydrochloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
3-(3-aminophenyl)benzonitrile;hydrochloride (CAS 1049744-24-2) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: 3-(3-aminophenyl)benzonitrile;hydrochloride. InChIKey: NYOUTQMBXQFWJN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 3-(3-aminophenyl)benzonitrile;hydrochloride |
| InChIKey | NYOUTQMBXQFWJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)N)C#N.Cl |
Computed by PubChem (NCBI)