Products 15424-14-3

CAS 15424-14-3 appears in our catalog under these names: N'-Phenylbenzohydrazonoyl chloride 95%, N'-Phenylbenzohydrazonoyl chloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(Z)-N-phenylbenzenecarbohydrazonoyl chloride (CAS 15424-14-3) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: (Z)-N-phenylbenzenecarbohydrazonoyl chloride. InChIKey: IUSCIWAUZVKPPY-SSZFMOIBSA-N.

Identity
Molecular formulaC13H11ClN2
Molecular weight230.69 g/mol
IUPAC name(Z)-N-phenylbenzenecarbohydrazonoyl chloride
InChIKeyIUSCIWAUZVKPPY-SSZFMOIBSA-N
SMILESC1=CC=C(C=C1)/C(=N/NC2=CC=CC=C2)/Cl

Computed by PubChem (NCBI)