CAS 7035-69-0 is the registry number for N-(4-Chlorophenyl)benzenecarboximidamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N'-(4-chlorophenyl)benzenecarboximidamide (CAS 7035-69-0) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: N'-(4-chlorophenyl)benzenecarboximidamide. InChIKey: JKSMLLRPARGTLT-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | N'-(4-chlorophenyl)benzenecarboximidamide |
| InChIKey | JKSMLLRPARGTLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)