CAS 5606-39-3 appears in our catalog under these names: Amoxapine Impurity 5, 4-Chloro-2(imino(phenyl)methyl)aniline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
2-(benzenecarboximidoyl)-4-chloroaniline (CAS 5606-39-3) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: 2-(benzenecarboximidoyl)-4-chloroaniline. InChIKey: QNIUWWCDBYUWGZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(benzenecarboximidoyl)-4-chloroaniline |
| InChIKey | QNIUWWCDBYUWGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=N)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)