CAS 25823-53-4 appears in our catalog under these names: 5-Chloro-3,4-diazatricyclo(9.4.0.0,2,7)pentadeca-1(15),2(7),3,5,11,13-hexaene, 3-Chloro-6,7-dihydro-5H-benzo[6,7]cyclohepta[1,2-c]pyridazine, 96%, 96%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene (CAS 25823-53-4) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: 5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene. InChIKey: PJMKITDIWYPIHU-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene |
| InChIKey | PJMKITDIWYPIHU-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C3=NN=C(C=C3C1)Cl |
Computed by PubChem (NCBI)