CAS 134-50-9 is the registry number for Acridine-9-amine Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
9-aminoacridine hydrochloride is a hydrochloride salt resulting from the reaction of equimolar amounts of 9-aminoacridine and hydrogen chloride. It has a role as a mutagen, an antiinfective agent and an antiseptic drug. It contains a 9-aminoacridine(1+).
Source: ChEBI
| Molecular formula | C13H11ClN2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | acridin-9-amine;hydrochloride |
| InChIKey | FTGPOQQGJVJDCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)N.Cl |
Computed by PubChem (NCBI)