Products 1240313-95-4

CAS 1240313-95-4 is the registry number for 3-(1-Naphthyl)-1h-pyrazole hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-naphthalen-1-yl-1H-pyrazole;hydrochloride (CAS 1240313-95-4) is a chemical compound with the molecular formula C13H11ClN2 and a molecular weight of 230.69 g/mol. IUPAC name: 5-naphthalen-1-yl-1H-pyrazole;hydrochloride. InChIKey: KMVSZGUGDGGGMM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClN2
Molecular weight230.69 g/mol
IUPAC name5-naphthalen-1-yl-1H-pyrazole;hydrochloride
InChIKeyKMVSZGUGDGGGMM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2C3=CC=NN3.Cl

Computed by PubChem (NCBI)