Products 1052527-15-7
CAS 1052527-15-7 is the registry number for 4-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)thiazol-2-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1052527-15-7) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: VBAFHESUNIEPDS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2S |
|---|---|
| Molecular weight | 270.74 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | VBAFHESUNIEPDS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)