CAS 1271453-28-1 is the registry number for 5-Chloro-2-(1,1-dioxo-1λâ¶-thiomorpholin-4-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile (CAS 1271453-28-1) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 5-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile. InChIKey: VMKSBEUOQIWPIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2S |
|---|---|
| Molecular weight | 270.74 g/mol |
| IUPAC name | 5-chloro-2-(1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile |
| InChIKey | VMKSBEUOQIWPIZ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=C(C=C(C=C2)Cl)C#N |
Computed by PubChem (NCBI)