Products 1221342-59-1
CAS 1221342-59-1 appears in our catalog under these names: 5-Chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole, 95%, 5-Chloro-3-(3,4-dimethoxybenzyl)-1,2,4-thiadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole (CAS 1221342-59-1) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole. InChIKey: UGRIPVJQHKCTFL-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2S |
|---|---|
| Molecular weight | 270.74 g/mol |
| IUPAC name | 5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole |
| InChIKey | UGRIPVJQHKCTFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=NSC(=N2)Cl)OC |
Computed by PubChem (NCBI)