Products 61320-20-5

CAS 61320-20-5 is the registry number for 4-(3,5-Dimethyl-1h-pyrazol-1-yl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride (CAS 61320-20-5) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride. InChIKey: MYKMFSJLSQTYNU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O2S
Molecular weight270.74 g/mol
IUPAC name4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride
InChIKeyMYKMFSJLSQTYNU-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C2=CC=C(C=C2)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)