CAS 61320-20-5 is the registry number for 4-(3,5-Dimethyl-1h-pyrazol-1-yl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride (CAS 61320-20-5) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride. InChIKey: MYKMFSJLSQTYNU-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2S |
|---|---|
| Molecular weight | 270.74 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride |
| InChIKey | MYKMFSJLSQTYNU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)