Products 2031258-60-1

CAS 2031258-60-1 is the registry number for 1-(2-Phenylethyl)-1H-pyrazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-phenylethyl)pyrazole-3-sulfonyl chloride (CAS 2031258-60-1) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 2-(2-phenylethyl)pyrazole-3-sulfonyl chloride. InChIKey: MHVZATJLMKCQFY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O2S
Molecular weight270.74 g/mol
IUPAC name2-(2-phenylethyl)pyrazole-3-sulfonyl chloride
InChIKeyMHVZATJLMKCQFY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCN2C(=CC=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)