CAS 113851-63-1 is the registry number for Hexythiazox Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-5-(4-chlorophenyl)-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide (CAS 113851-63-1) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: (4S,5S)-5-(4-chlorophenyl)-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide. InChIKey: OWQQVISJIKLFDY-IMTBSYHQSA-N.
| Molecular formula | C11H11ClN2O2S |
|---|---|
| Molecular weight | 270.74 g/mol |
| IUPAC name | (4S,5S)-5-(4-chlorophenyl)-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide |
| InChIKey | OWQQVISJIKLFDY-IMTBSYHQSA-N |
| SMILES | C[C@H]1[C@@H](SC(=O)N1C(=O)N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)