Products 59340-26-0

CAS 59340-26-0 appears in our catalog under these names: 3,5-Dimethyl-1-phenyl-1h-pyrazole-4-sulfonyl chloride, 95%, 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-sulfonyl chloride 95%, 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-sulfonylchloride, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,5-dimethyl-1-phenylpyrazole-4-sulfonyl chloride (CAS 59340-26-0) is a chemical compound with the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-sulfonyl chloride. InChIKey: YOZYVZVQEADZEV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O2S
Molecular weight270.74 g/mol
IUPAC name3,5-dimethyl-1-phenylpyrazole-4-sulfonyl chloride
InChIKeyYOZYVZVQEADZEV-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=CC=CC=C2)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)