CAS 105355-37-1 is the registry number for 3-Chloro-4-((5-chloropyrimidin-2-yl)oxy)aniline. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-chloro-4-(5-chloropyrimidin-2-yl)oxyaniline (CAS 105355-37-1) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: 3-chloro-4-(5-chloropyrimidin-2-yl)oxyaniline. InChIKey: OQPORDRGBPPVJX-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 3-chloro-4-(5-chloropyrimidin-2-yl)oxyaniline |
| InChIKey | OQPORDRGBPPVJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)OC2=NC=C(C=N2)Cl |
Computed by PubChem (NCBI)