CAS 30886-24-9 is the registry number for 2-(Benzyloxy)-4,6-dichloro-1,3,5-triazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dichloro-6-phenylmethoxy-1,3,5-triazine (CAS 30886-24-9) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: 2,4-dichloro-6-phenylmethoxy-1,3,5-triazine. InChIKey: BLYRMYBCLLKQBV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 2,4-dichloro-6-phenylmethoxy-1,3,5-triazine |
| InChIKey | BLYRMYBCLLKQBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)