Products 105382-08-9
CAS 105382-08-9 is the registry number for D-(R)-Homophenylalanine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(2R)-2-amino-4-phenylbutanoic acid;hydrochloride (CAS 105382-08-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2R)-2-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: CHBMONIBOQCTCF-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2R)-2-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | CHBMONIBOQCTCF-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-(R)-Homophenylalanine HCl, H-D-HoPhe-OH HCl, (R)-2-Amino-4-phenylbutanoic Acid Hydrochloride, (2R)-2-amino-4-phenylbutanoic acid;hydrochloride, L-Homophenylalanine hydrochloride, D-(R)-Homophenylalanine Hydrochloride, D-(R)-HomophenylalanineHCl, D-Homophenylalanine hydrochloride, CHBMONIBOQCTCF-SBSPUUFOSA-N, [(1R)-1-carboxy-3-phenyl-propyl]ammonium;chloride