CAS 105382-09-0 appears in our catalog under these names: L-Homophenylalanine hydrochloride, 97%, H-β-HoPhe-OH·HCl 98%, L-Homophenylalanine, HCl, 98%, 98%, (S)-2-Amino-4-phenylbutanoic acid hydrochloride. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
(2S)-2-amino-4-phenylbutanoic acid;hydrochloride (CAS 105382-09-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2S)-2-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: CHBMONIBOQCTCF-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2S)-2-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | CHBMONIBOQCTCF-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)