Products 21176-60-3
CAS 21176-60-3 appears in our catalog under these names: 2-Amino-4-phenylbutanoic acid hydrochloride, 95%, L-Homophenylalanine hydrochloride, L-HOMOPHENYLALANINE HYDROCHLORIDE SALT,&. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich. Available pack sizes: 10g, 5g, 1g, 2,5g, 0,25g.
2-amino-4-phenylbutanoic acid;hydrochloride (CAS 21176-60-3) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: CHBMONIBOQCTCF-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 2-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | CHBMONIBOQCTCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-amino-4-phenylbutyric acid, hydrochloride, 2-amino-4-phenylbutanoic acid hydrochloride, L-Homophenylalanine hydrochloride, D-(R)-Homophenylalanine HCl, 2-amino-4-phenylbutanoic acid;hydrochloride, L-beta-homo-phe.hcl, (2S)-2-amino-4-phenylbutanoic acid;hydrochloride, H-D-HoPhe-OH.HCl, 2-amino-4-phenyl-butanoic acid;hydrochloride, L-Homophenylalanine inverted exclamation mark currencyHcl Salt