CAS 105752-18-9 is the registry number for 4-Ethynyl-1-methoxy-2-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-ethynyl-1-methoxy-2-nitrobenzene (CAS 105752-18-9) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 4-ethynyl-1-methoxy-2-nitrobenzene. InChIKey: TYAHQTZBCRBZMV-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-ethynyl-1-methoxy-2-nitrobenzene |
| InChIKey | TYAHQTZBCRBZMV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#C)[N+](=O)[O-] |
Computed by PubChem (NCBI)