CAS 105807-79-2 appears in our catalog under these names: 7-Amino-2-methyl-2h-1,4-benzoxazin-3(4h)-one, 95%, 7-amino-2-methyl-2H-1,4-benzoxazin-3(4H)-one. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
7-amino-2-methyl-4H-1,4-benzoxazin-3-one (CAS 105807-79-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-amino-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: TVSVYAABMPJFIR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-amino-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | TVSVYAABMPJFIR-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)N |
Computed by PubChem (NCBI)