CAS 1060810-27-6 is the registry number for 3-Chloro-6-(trifluoromethyl)picolinaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-6-(trifluoromethyl)pyridine-2-carbaldehyde (CAS 1060810-27-6) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 3-chloro-6-(trifluoromethyl)pyridine-2-carbaldehyde. InChIKey: SARHUZHQSTUDAM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 3-chloro-6-(trifluoromethyl)pyridine-2-carbaldehyde |
| InChIKey | SARHUZHQSTUDAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C=O)C(F)(F)F |
Computed by PubChem (NCBI)