Products 1060811-90-6
CAS 1060811-90-6 is the registry number for 1-(6-Chloropyridin-2-yl)-2,2,2-trifluoroethanone, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-chloro-2-pyridinyl)-2,2,2-trifluoroethanone (CAS 1060811-90-6) is a chemical compound with the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. IUPAC name: 1-(6-chloro-2-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: QERWSIMZVTWIGA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO |
|---|---|
| Molecular weight | 209.55 g/mol |
| IUPAC name | 1-(6-chloro-2-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | QERWSIMZVTWIGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)