CAS 1060815-99-7 appears in our catalog under these names: Ethyl 2-(trifluoromethyl)-1,3-oxazole-4-carboxylate, 95%, Ethyl 2-(trifluoromethyl)-1,3-oxazole-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-(trifluoromethyl)-1,3-oxazole-4-carboxylate (CAS 1060815-99-7) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: ethyl 2-(trifluoromethyl)-1,3-oxazole-4-carboxylate. InChIKey: WLTXOCFHAKNLBB-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | ethyl 2-(trifluoromethyl)-1,3-oxazole-4-carboxylate |
| InChIKey | WLTXOCFHAKNLBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC(=N1)C(F)(F)F |
Computed by PubChem (NCBI)