Products 1499593-02-0

CAS 1499593-02-0 is the registry number for 4-Ethyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-ethyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (CAS 1499593-02-0) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: 4-ethyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid. InChIKey: UDLZYZHINDSRFI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO3
Molecular weight209.12 g/mol
IUPAC name4-ethyl-2-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid
InChIKeyUDLZYZHINDSRFI-UHFFFAOYSA-N
SMILESCCC1=C(OC(=N1)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)