CAS 1341552-49-5 is the registry number for Ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate (CAS 1341552-49-5) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate. InChIKey: VQXLITGNNDFCMM-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate |
| InChIKey | VQXLITGNNDFCMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1)C(F)(F)F |
Computed by PubChem (NCBI)