Products 1341552-49-5

CAS 1341552-49-5 is the registry number for Ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate (CAS 1341552-49-5) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate. InChIKey: VQXLITGNNDFCMM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO3
Molecular weight209.12 g/mol
IUPAC nameethyl 5-(trifluoromethyl)-1,2-oxazole-4-carboxylate
InChIKeyVQXLITGNNDFCMM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(ON=C1)C(F)(F)F

Computed by PubChem (NCBI)