CAS 1375248-22-8 appears in our catalog under these names: 5-(3,3,3-Trifluoropropyl)-1,3-oxazole-4-carboxylic acid, 95%, 5-(3,3,3-Trifluoropropyl)-1,3-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(3,3,3-trifluoropropyl)-1,3-oxazole-4-carboxylic acid (CAS 1375248-22-8) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: 5-(3,3,3-trifluoropropyl)-1,3-oxazole-4-carboxylic acid. InChIKey: CDWNXJFAWVEXAG-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | 5-(3,3,3-trifluoropropyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | CDWNXJFAWVEXAG-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(O1)CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)