CAS 2735653-86-6 is the registry number for 3-(3,3,3-Trifluoropropyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,3,3-trifluoropropyl)-1,2-oxazole-4-carboxylic acid (CAS 2735653-86-6) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: 3-(3,3,3-trifluoropropyl)-1,2-oxazole-4-carboxylic acid. InChIKey: RMCPTQIFBHUEHG-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | 3-(3,3,3-trifluoropropyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | RMCPTQIFBHUEHG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NO1)CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)