CAS 1126633-32-6 appears in our catalog under these names: Ethyl 4-(trifluoromethyl)-1,3-oxazole-5-carboxylate, 95%, Ethyl 4-(trifluoromethyl)-1,3-oxazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 4-(trifluoromethyl)-1,3-oxazole-5-carboxylate (CAS 1126633-32-6) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: ethyl 4-(trifluoromethyl)-1,3-oxazole-5-carboxylate. InChIKey: XNWPXJFSPSKGHM-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | ethyl 4-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | XNWPXJFSPSKGHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CO1)C(F)(F)F |
Computed by PubChem (NCBI)