Products 1303890-42-7

CAS 1303890-42-7 is the registry number for 2,2,2-Trifluoroethyl N-(furan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl N-(furan-2-yl)carbamate (CAS 1303890-42-7) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(furan-2-yl)carbamate. InChIKey: JGFHPHSJQALYBE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO3
Molecular weight209.12 g/mol
IUPAC name2,2,2-trifluoroethyl N-(furan-2-yl)carbamate
InChIKeyJGFHPHSJQALYBE-UHFFFAOYSA-N
SMILESC1=COC(=C1)NC(=O)OCC(F)(F)F

Computed by PubChem (NCBI)