CAS 1303890-42-7 is the registry number for 2,2,2-Trifluoroethyl N-(furan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2,2-trifluoroethyl N-(furan-2-yl)carbamate (CAS 1303890-42-7) is a chemical compound with the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(furan-2-yl)carbamate. InChIKey: JGFHPHSJQALYBE-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO3 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(furan-2-yl)carbamate |
| InChIKey | JGFHPHSJQALYBE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)