Products 7501-68-0

CAS 7501-68-0 is the registry number for 4-Acetamidoisophthalic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

4-acetamidobenzene-1,3-dicarboxylic acid (CAS 7501-68-0) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 4-acetamidobenzene-1,3-dicarboxylic acid. InChIKey: KFABBSXAHCCRSK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO5
Molecular weight223.18 g/mol
IUPAC name4-acetamidobenzene-1,3-dicarboxylic acid
InChIKeyKFABBSXAHCCRSK-UHFFFAOYSA-N
SMILESCC(=O)NC1=C(C=C(C=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)