CAS 7501-68-0 is the registry number for 4-Acetamidoisophthalic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-acetamidobenzene-1,3-dicarboxylic acid (CAS 7501-68-0) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 4-acetamidobenzene-1,3-dicarboxylic acid. InChIKey: KFABBSXAHCCRSK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 4-acetamidobenzene-1,3-dicarboxylic acid |
| InChIKey | KFABBSXAHCCRSK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)