Products 2713997-59-0
CAS 2713997-59-0 is the registry number for (2-Chloro-5-fluoro-6-methylpyridine-3,4-diyl)dimethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-chloro-5-fluoro-3-(hydroxymethyl)-6-methyl-4-pyridinyl]methanol (CAS 2713997-59-0) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: [2-chloro-5-fluoro-3-(hydroxymethyl)-6-methyl-4-pyridinyl]methanol. InChIKey: ORHXVRZJBBLWDD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | [2-chloro-5-fluoro-3-(hydroxymethyl)-6-methyl-4-pyridinyl]methanol |
| InChIKey | ORHXVRZJBBLWDD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)Cl)CO)CO)F |
Computed by PubChem (NCBI)