CAS 1391441-60-3 appears in our catalog under these names: (R)-2-Amino-2-(2-fluorophenyl)acetic acid hydrochloride, 98%, (R)–2–Amino–2–(2–fluorophenyl)acetic acid hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg.
(2R)-2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride (CAS 1391441-60-3) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: (2R)-2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride. InChIKey: OHMMIUFKFKTOOW-OGFXRTJISA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-fluorophenyl)acetic acid;hydrochloride |
| InChIKey | OHMMIUFKFKTOOW-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)