Products 2126177-96-4
CAS 2126177-96-4 is the registry number for 1-(3-Amino-5-fluoro-4-hydroxyphenyl)ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-amino-5-fluoro-4-hydroxyphenyl)ethanone;hydrochloride (CAS 2126177-96-4) is a chemical compound with the molecular formula C8H9ClFNO2 and a molecular weight of 205.61 g/mol. IUPAC name: 1-(3-amino-5-fluoro-4-hydroxyphenyl)ethanone;hydrochloride. InChIKey: QKOBRXNBMGMXDS-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO2 |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 1-(3-amino-5-fluoro-4-hydroxyphenyl)ethanone;hydrochloride |
| InChIKey | QKOBRXNBMGMXDS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)O)N.Cl |
Computed by PubChem (NCBI)