CAS 1064364-21-1 is the registry number for 4’-C-Methyl-4-deoxyuridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one (CAS 1064364-21-1) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one. InChIKey: MKIZZXNZJLIWIA-IBCQBUCCSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one |
| InChIKey | MKIZZXNZJLIWIA-IBCQBUCCSA-N |
| SMILES | C[C@]1([C@H]([C@H]([C@@H](O1)N2C=CC=NC2=O)O)O)CO |
Computed by PubChem (NCBI)