Products 1064396-72-0
CAS 1064396-72-0 is the registry number for phenyl(3-(trifluoromethoxy)phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Phenyl-[3-(trifluoromethoxy)phenyl]methanol (CAS 1064396-72-0) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: phenyl-[3-(trifluoromethoxy)phenyl]methanol. InChIKey: ADLVWVBQALWKBU-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | phenyl-[3-(trifluoromethoxy)phenyl]methanol |
| InChIKey | ADLVWVBQALWKBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)