CAS 1065074-15-8 is the registry number for 4-(2-Fluorophenyl)-1H-1,2,4-triazol-5(4H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(2-fluorophenyl)-1H-1,2,4-triazol-5-one (CAS 1065074-15-8) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 4-(2-fluorophenyl)-1H-1,2,4-triazol-5-one. InChIKey: RUAZYMIYEVXDRP-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | RUAZYMIYEVXDRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=NNC2=O)F |
Computed by PubChem (NCBI)