CAS 1378451-55-8 is the registry number for 2-Amino-7-fluoro-4(3h)-quinazolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-7-fluoro-3H-quinazolin-4-one (CAS 1378451-55-8) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 2-amino-7-fluoro-3H-quinazolin-4-one. InChIKey: IRBJUDZHLBICJG-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 2-amino-7-fluoro-3H-quinazolin-4-one |
| InChIKey | IRBJUDZHLBICJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(NC2=O)N |
Computed by PubChem (NCBI)