CAS 283584-52-1 appears in our catalog under these names: 5-Fluoro-3-hydrazonoindolin-2-one, 95%, Sunitinib Impurity 21, 5-Fluoro-1H-indole-2,3-dione 3-Hydrazone, >95% (HPLC), 5–Fluoro–3–hydrazonoindolin–2–one, 5-Fluoro-3-hydrazonoindolin-2-one. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 1g, on request, 500mg, 100mg, 250mg, 1000mg, 10000mg.
3-diazenyl-5-fluoro-1H-indol-2-ol (CAS 283584-52-1) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 3-diazenyl-5-fluoro-1H-indol-2-ol. InChIKey: NBUZIGMUYFFWDD-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 3-diazenyl-5-fluoro-1H-indol-2-ol |
| InChIKey | NBUZIGMUYFFWDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=C(N2)O)N=N |
Computed by PubChem (NCBI)