CAS 312272-59-6 appears in our catalog under these names: 5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-amine, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 200g.
5-(2-fluorophenyl)-1,3,4-oxadiazol-2-amine (CAS 312272-59-6) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: JZHJJYLHTLIBEY-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | JZHJJYLHTLIBEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)N)F |
Computed by PubChem (NCBI)