Products 341978-66-3
CAS 341978-66-3 appears in our catalog under these names: 5-(3-Fluorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3-Fluorophenyl)-1,3,4-oxadiazol-2-amine 95+%, 5-(3-fluorophenyl)-1,3,4-oxadiazol-2-amine, 95+%, 5-(3-Fluorophenyl)-1,3,4-oxadiazol-2-amine, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g.
5-(3-fluorophenyl)-1,3,4-oxadiazol-2-amine (CAS 341978-66-3) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 5-(3-fluorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: MECVUWDGVBDYDC-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | MECVUWDGVBDYDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN=C(O2)N |
Computed by PubChem (NCBI)