Products 1443146-48-2
CAS 1443146-48-2 is the registry number for 1-(6-Fluoroimidazo[1,2-b]pyridazin-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS 1443146-48-2) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone. InChIKey: XGQIESXAAFUVOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone |
| InChIKey | XGQIESXAAFUVOQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C2N1N=C(C=C2)F |
Computed by PubChem (NCBI)