CAS 21742-05-2 is the registry number for 4-(2-Fluorophenyl)-1,2,5-oxadiazol-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2-fluorophenyl)-1,2,5-oxadiazol-3-amine (CAS 21742-05-2) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,2,5-oxadiazol-3-amine. InChIKey: CHYRTZDRTVDTOT-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,2,5-oxadiazol-3-amine |
| InChIKey | CHYRTZDRTVDTOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NON=C2N)F |
Computed by PubChem (NCBI)