Products 1065102-58-0
CAS 1065102-58-0 is the registry number for 2-(3-Fluorophenyl)-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(3-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 1065102-58-0) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: BWSJZWQFDHYZHY-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | BWSJZWQFDHYZHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)