Products 1065559-56-9
CAS 1065559-56-9 appears in our catalog under these names: SMND-309, Smnd-309, 96.81%, 96.81%, SMND-309, 97.12%, SMND-309 (Standard). Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 5 mg, Get quote, 1 mg, 10mM/1mL.
(E)-2-[6-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (CAS 1065559-56-9) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: (E)-2-[6-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid. InChIKey: OAHRXWZJURTMHG-ACIWFXKJSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (E)-2-[6-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| InChIKey | OAHRXWZJURTMHG-ACIWFXKJSA-N |
| SMILES | C1=CC(=C(C=C1/C=C(\C2=C(C=CC(=C2O)O)/C=C/C(=O)O)/C(=O)O)O)O |
Computed by PubChem (NCBI)